C21H28N2O3 — CID 110498942
3-[ethyl-(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]propanoic acid (PubChem CID 110498942) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 3-[ethyl-(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-[ethyl-(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 110498942 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 3-[ethyl-(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]propanoic acid |
| SMILES | C=CCn1c(C(=O)N(CC)CCC(=O)O)c(C)c2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C21H28N2O3/c1-6-11-23-18-9-8-16(14(3)4)13-17(18)15(5)20(23)21(26)22(7-2)12-10-19(24)25/h6,8-9,13-14H,1,7,10-12H2,2-5H3,(H,24,25) |
| InChIKey | CJUDJUNBPSOFCC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|