C22H30N2O3 — CID 110498943
3-[(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)-propylamino]propanoic acid (PubChem CID 110498943) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is 3-[(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)-propylamino]propanoic acid.
| Compound Name | 3-[(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)-propylamino]propanoic acid |
|---|---|
| PubChem CID | 110498943 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 3-[(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)-propylamino]propanoic acid |
| SMILES | C=CCn1c(C(=O)N(CCC)CCC(=O)O)c(C)c2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C22H30N2O3/c1-6-11-23(13-10-20(25)26)22(27)21-16(5)18-14-17(15(3)4)8-9-19(18)24(21)12-7-2/h7-9,14-15H,2,6,10-13H2,1,3-5H3,(H,25,26) |
| InChIKey | PBIPHABGJPBCJZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|