C30H26N2O3 — CID 110501979
N-(9,10-dioxoanthracen-2-yl)-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide (PubChem CID 110501979) has the molecular formula C30H26N2O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide |
|---|---|
| PubChem CID | 110501979 |
| Molecular Formula | C30H26N2O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide |
| SMILES | C=CCn1c(C(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)c(C)c2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C30H26N2O3/c1-5-14-32-26-13-10-19(17(2)3)15-24(26)18(4)27(32)30(35)31-20-11-12-23-25(16-20)29(34)22-9-7-6-8-21(22)28(23)33/h5-13,15-17H,1,14H2,2-4H3,(H,31,35) |
| InChIKey | QKGSOLHJOGVLJF-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|