C22H22F2N2O — CID 110501995
N-(3,4-difluorophenyl)-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide (PubChem CID 110501995) has the molecular formula C22H22F2N2O and a molecular weight of 368.43 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide |
|---|---|
| PubChem CID | 110501995 |
| Molecular Formula | C22H22F2N2O |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-(3,4-difluorophenyl)-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide |
| SMILES | C=CCn1c(C(=O)Nc2ccc(F)c(F)c2)c(C)c2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C22H22F2N2O/c1-5-10-26-20-9-6-15(13(2)3)11-17(20)14(4)21(26)22(27)25-16-7-8-18(23)19(24)12-16/h5-9,11-13H,1,10H2,2-4H3,(H,25,27) |
| InChIKey | MZTGBHNTVBICSC-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|