C29H29ClN2O2 — CID 110501965
N-[4-[(4-chlorophenyl)methoxy]phenyl]-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide (PubChem CID 110501965) has the molecular formula C29H29ClN2O2 and a molecular weight of 473.02 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)methoxy]phenyl]-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide.
| Compound Name | N-[4-[(4-chlorophenyl)methoxy]phenyl]-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide |
|---|---|
| PubChem CID | 110501965 |
| Molecular Formula | C29H29ClN2O2 |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | N-[4-[(4-chlorophenyl)methoxy]phenyl]-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide |
| SMILES | C=CCn1c(C(=O)Nc2ccc(OCc3ccc(Cl)cc3)cc2)c(C)c2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C29H29ClN2O2/c1-5-16-32-27-15-8-22(19(2)3)17-26(27)20(4)28(32)29(33)31-24-11-13-25(14-12-24)34-18-21-6-9-23(30)10-7-21/h5-15,17,19H,1,16,18H2,2-4H3,(H,31,33) |
| InChIKey | ZHEYIXIRVZSARO-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|