C28H34N2O6S — CID 110503834
4-O-ethyl 2-O-(2-methoxyethyl) 3-methyl-5-[(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]thiophene-2,4-dicarboxylate (PubChem CID 110503834) has the molecular formula C28H34N2O6S and a molecular weight of 526.66 g/mol. Its IUPAC name is 4-O-ethyl 2-O-(2-methoxyethyl) 3-methyl-5-[(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]thiophene-2,4-dicarboxylate.
| Compound Name | 4-O-ethyl 2-O-(2-methoxyethyl) 3-methyl-5-[(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 110503834 |
| Molecular Formula | C28H34N2O6S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 4-O-ethyl 2-O-(2-methoxyethyl) 3-methyl-5-[(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]thiophene-2,4-dicarboxylate |
| SMILES | C=CCn1c(C(=O)Nc2sc(C(=O)OCCOC)c(C)c2C(=O)OCC)c(C)c2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C28H34N2O6S/c1-8-12-30-21-11-10-19(16(3)4)15-20(21)17(5)23(30)25(31)29-26-22(27(32)35-9-2)18(6)24(37-26)28(33)36-14-13-34-7/h8,10-11,15-16H,1,9,12-14H2,2-7H3,(H,29,31) |
| InChIKey | XKZVBTUBTLHVAG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|