C28H31N3OS — CID 110503859
N-[4-(3,4-dimethylphenyl)-5-methyl-1,3-thiazol-2-yl]-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide (PubChem CID 110503859) has the molecular formula C28H31N3OS and a molecular weight of 457.64 g/mol. Its IUPAC name is N-[4-(3,4-dimethylphenyl)-5-methyl-1,3-thiazol-2-yl]-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide.
| Compound Name | N-[4-(3,4-dimethylphenyl)-5-methyl-1,3-thiazol-2-yl]-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide |
|---|---|
| PubChem CID | 110503859 |
| Molecular Formula | C28H31N3OS |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-[4-(3,4-dimethylphenyl)-5-methyl-1,3-thiazol-2-yl]-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide |
| SMILES | C=CCn1c(C(=O)Nc2nc(-c3ccc(C)c(C)c3)c(C)s2)c(C)c2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C28H31N3OS/c1-8-13-31-24-12-11-21(16(2)3)15-23(24)19(6)26(31)27(32)30-28-29-25(20(7)33-28)22-10-9-17(4)18(5)14-22/h8-12,14-16H,1,13H2,2-7H3,(H,29,30,32) |
| InChIKey | HGBVUDUKHSSZCW-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|