C23H32N2O3 — CID 110498940
ethyl 3-[ethyl-(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]propanoate (PubChem CID 110498940) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is ethyl 3-[ethyl-(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]propanoate.
| Compound Name | ethyl 3-[ethyl-(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 110498940 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | ethyl 3-[ethyl-(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]propanoate |
| SMILES | C=CCn1c(C(=O)N(CC)CCC(=O)OCC)c(C)c2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C23H32N2O3/c1-7-13-25-20-11-10-18(16(4)5)15-19(20)17(6)22(25)23(27)24(8-2)14-12-21(26)28-9-3/h7,10-11,15-16H,1,8-9,12-14H2,2-6H3 |
| InChIKey | NRSAILSVVRMMLX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|