C22H30N2O — CID 110498899
(2-methylpiperidin-1-yl)-(3-methyl-5-propan-2-yl-1-prop-2-enylindol-2-yl)methanone (PubChem CID 110498899) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is (2-methylpiperidin-1-yl)-(3-methyl-5-propan-2-yl-1-prop-2-enylindol-2-yl)methanone.
| Compound Name | (2-methylpiperidin-1-yl)-(3-methyl-5-propan-2-yl-1-prop-2-enylindol-2-yl)methanone |
|---|---|
| PubChem CID | 110498899 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | (2-methylpiperidin-1-yl)-(3-methyl-5-propan-2-yl-1-prop-2-enylindol-2-yl)methanone |
| SMILES | C=CCn1c(C(=O)N2CCCCC2C)c(C)c2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C22H30N2O/c1-6-12-24-20-11-10-18(15(2)3)14-19(20)17(5)21(24)22(25)23-13-8-7-9-16(23)4/h6,10-11,14-16H,1,7-9,12-13H2,2-5H3 |
| InChIKey | DTZCNUYUWHIPLB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|