C19H25ClN2O — CID 110498961
(5-chloro-1-ethyl-3-methylindol-2-yl)-(2-ethylpiperidin-1-yl)methanone (PubChem CID 110498961) has the molecular formula C19H25ClN2O and a molecular weight of 332.88 g/mol. Its IUPAC name is (5-chloro-1-ethyl-3-methylindol-2-yl)-(2-ethylpiperidin-1-yl)methanone.
| Compound Name | (5-chloro-1-ethyl-3-methylindol-2-yl)-(2-ethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 110498961 |
| Molecular Formula | C19H25ClN2O |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (5-chloro-1-ethyl-3-methylindol-2-yl)-(2-ethylpiperidin-1-yl)methanone |
| SMILES | CCC1CCCCN1C(=O)c1c(C)c2cc(Cl)ccc2n1CC |
| InChI | InChI=1S/C19H25ClN2O/c1-4-15-8-6-7-11-22(15)19(23)18-13(3)16-12-14(20)9-10-17(16)21(18)5-2/h9-10,12,15H,4-8,11H2,1-3H3 |
| InChIKey | WCGKQMAHRFYWKZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|