C21H30N2O2 — CID 110499037
(5-ethoxy-1-ethyl-3-methylindol-2-yl)-(2-ethylpiperidin-1-yl)methanone (PubChem CID 110499037) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is (5-ethoxy-1-ethyl-3-methylindol-2-yl)-(2-ethylpiperidin-1-yl)methanone.
| Compound Name | (5-ethoxy-1-ethyl-3-methylindol-2-yl)-(2-ethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 110499037 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | (5-ethoxy-1-ethyl-3-methylindol-2-yl)-(2-ethylpiperidin-1-yl)methanone |
| SMILES | CCOc1ccc2c(c1)c(C)c(C(=O)N1CCCCC1CC)n2CC |
| InChI | InChI=1S/C21H30N2O2/c1-5-16-10-8-9-13-23(16)21(24)20-15(4)18-14-17(25-7-3)11-12-19(18)22(20)6-2/h11-12,14,16H,5-10,13H2,1-4H3 |
| InChIKey | DOTVYKSGWOSUTJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|