C20H28N2O3 — CID 110499054
(2,6-dimethylmorpholin-4-yl)-(5-ethoxy-1-ethyl-3-methylindol-2-yl)methanone (PubChem CID 110499054) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is (2,6-dimethylmorpholin-4-yl)-(5-ethoxy-1-ethyl-3-methylindol-2-yl)methanone.
| Compound Name | (2,6-dimethylmorpholin-4-yl)-(5-ethoxy-1-ethyl-3-methylindol-2-yl)methanone |
|---|---|
| PubChem CID | 110499054 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (2,6-dimethylmorpholin-4-yl)-(5-ethoxy-1-ethyl-3-methylindol-2-yl)methanone |
| SMILES | CCOc1ccc2c(c1)c(C)c(C(=O)N1CC(C)OC(C)C1)n2CC |
| InChI | InChI=1S/C20H28N2O3/c1-6-22-18-9-8-16(24-7-2)10-17(18)15(5)19(22)20(23)21-11-13(3)25-14(4)12-21/h8-10,13-14H,6-7,11-12H2,1-5H3 |
| InChIKey | GQXFQSRJYKBVCO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|