C22H22NO5S- — CID 7308941
(1R,6S)-6-[[3-ethoxycarbonyl-4-(3-methylphenyl)thiophen-2-yl]carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 7308941) has the molecular formula C22H22NO5S- and a molecular weight of 412.49 g/mol. Its IUPAC name is (1R,6S)-6-[[3-ethoxycarbonyl-4-(3-methylphenyl)thiophen-2-yl]carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1R,6S)-6-[[3-ethoxycarbonyl-4-(3-methylphenyl)thiophen-2-yl]carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7308941 |
| Molecular Formula | C22H22NO5S- |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (1R,6S)-6-[[3-ethoxycarbonyl-4-(3-methylphenyl)thiophen-2-yl]carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccc(C)c2)csc1NC(=O)[C@H]1CC=CC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C22H23NO5S/c1-3-28-22(27)18-17(14-8-6-7-13(2)11-14)12-29-20(18)23-19(24)15-9-4-5-10-16(15)21(25)26/h4-8,11-12,15-16H,3,9-10H2,1-2H3,(H,23,24)(H,25,26)/p-1/t15-,16+/m0/s1 |
| InChIKey | LEEADSBKBGVHNS-JKSUJKDBSA-M |
| XLogP | 3.17 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|