C18H16NO6S- — CID 7013498
(1R,6S)-6-[[4-(furan-2-yl)-3-methoxycarbonylthiophen-2-yl]carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 7013498) has the molecular formula C18H16NO6S- and a molecular weight of 374.39 g/mol. Its IUPAC name is (1R,6S)-6-[[4-(furan-2-yl)-3-methoxycarbonylthiophen-2-yl]carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1R,6S)-6-[[4-(furan-2-yl)-3-methoxycarbonylthiophen-2-yl]carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7013498 |
| Molecular Formula | C18H16NO6S- |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | (1R,6S)-6-[[4-(furan-2-yl)-3-methoxycarbonylthiophen-2-yl]carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)c1c(-c2ccco2)csc1NC(=O)[C@H]1CC=CC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C18H17NO6S/c1-24-18(23)14-12(13-7-4-8-25-13)9-26-16(14)19-15(20)10-5-2-3-6-11(10)17(21)22/h2-4,7-11H,5-6H2,1H3,(H,19,20)(H,21,22)/p-1/t10-,11+/m0/s1 |
| InChIKey | YAWARYLQJLDONP-WDEREUQCSA-M |
| XLogP | 2.07 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|