C16H18NO5S- — CID 4745905
6-[(3-methoxycarbonyl-4,5-dimethylthiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 4745905) has the molecular formula C16H18NO5S- and a molecular weight of 336.39 g/mol. Its IUPAC name is 6-[(3-methoxycarbonyl-4,5-dimethylthiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | 6-[(3-methoxycarbonyl-4,5-dimethylthiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 4745905 |
| Molecular Formula | C16H18NO5S- |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 6-[(3-methoxycarbonyl-4,5-dimethylthiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C2CC=CCC2C(=O)[O-])sc(C)c1C |
| InChI | InChI=1S/C16H19NO5S/c1-8-9(2)23-14(12(8)16(21)22-3)17-13(18)10-6-4-5-7-11(10)15(19)20/h4-5,10-11H,6-7H2,1-3H3,(H,17,18)(H,19,20)/p-1 |
| InChIKey | FNDVHCVMFHSSRH-UHFFFAOYSA-M |
| XLogP | 1.42 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|