C16H13ClNO5S- — CID 4217639
4-[[4-(2-chlorophenyl)-3-methoxycarbonylthiophen-2-yl]amino]-4-oxobutanoate (PubChem CID 4217639) has the molecular formula C16H13ClNO5S- and a molecular weight of 366.80 g/mol. Its IUPAC name is 4-[[4-(2-chlorophenyl)-3-methoxycarbonylthiophen-2-yl]amino]-4-oxobutanoate.
| Compound Name | 4-[[4-(2-chlorophenyl)-3-methoxycarbonylthiophen-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4217639 |
| Molecular Formula | C16H13ClNO5S- |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 4-[[4-(2-chlorophenyl)-3-methoxycarbonylthiophen-2-yl]amino]-4-oxobutanoate |
| SMILES | COC(=O)c1c(-c2ccccc2Cl)csc1NC(=O)CCC(=O)[O-] |
| InChI | InChI=1S/C16H14ClNO5S/c1-23-16(22)14-10(9-4-2-3-5-11(9)17)8-24-15(14)18-12(19)6-7-13(20)21/h2-5,8H,6-7H2,1H3,(H,18,19)(H,20,21)/p-1 |
| InChIKey | OGZQETXUJDPHMY-UHFFFAOYSA-M |
| XLogP | 2.32 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|