C24H20ClN3O5S — CID 24565745
methyl 4-(2-chlorophenyl)-2-[[2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]amino]thiophene-3-carboxylate (PubChem CID 24565745) has the molecular formula C24H20ClN3O5S and a molecular weight of 497.96 g/mol. Its IUPAC name is methyl 4-(2-chlorophenyl)-2-[[2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(2-chlorophenyl)-2-[[2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 24565745 |
| Molecular Formula | C24H20ClN3O5S |
| Molecular Weight | 497.96 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | methyl 4-(2-chlorophenyl)-2-[[2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2Cl)csc1NC(=O)CN1C(=O)NC(C)(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H20ClN3O5S/c1-24(14-8-4-3-5-9-14)22(31)28(23(32)27-24)12-18(29)26-20-19(21(30)33-2)16(13-34-20)15-10-6-7-11-17(15)25/h3-11,13H,12H2,1-2H3,(H,26,29)(H,27,32) |
| InChIKey | KVKBYRVJERVEOY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.96 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|