C17H16ClNO5S2 — CID 24571172
methyl 4-(2-chlorophenyl)-2-[[2-(2-methoxy-2-oxoethyl)sulfanylacetyl]amino]thiophene-3-carboxylate (PubChem CID 24571172) has the molecular formula C17H16ClNO5S2 and a molecular weight of 413.90 g/mol. Its IUPAC name is methyl 4-(2-chlorophenyl)-2-[[2-(2-methoxy-2-oxoethyl)sulfanylacetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(2-chlorophenyl)-2-[[2-(2-methoxy-2-oxoethyl)sulfanylacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 24571172 |
| Molecular Formula | C17H16ClNO5S2 |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | methyl 4-(2-chlorophenyl)-2-[[2-(2-methoxy-2-oxoethyl)sulfanylacetyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)CSCC(=O)Nc1scc(-c2ccccc2Cl)c1C(=O)OC |
| InChI | InChI=1S/C17H16ClNO5S2/c1-23-14(21)9-25-8-13(20)19-16-15(17(22)24-2)11(7-26-16)10-5-3-4-6-12(10)18/h3-7H,8-9H2,1-2H3,(H,19,20) |
| InChIKey | ZROOXWGBFUGOSQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|