C17H13ClN2O3S2 — CID 71890603
methyl 4-(2-chlorophenyl)-2-[(4-methyl-1,3-thiazole-5-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 71890603) has the molecular formula C17H13ClN2O3S2 and a molecular weight of 392.89 g/mol. Its IUPAC name is methyl 4-(2-chlorophenyl)-2-[(4-methyl-1,3-thiazole-5-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(2-chlorophenyl)-2-[(4-methyl-1,3-thiazole-5-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 71890603 |
| Molecular Formula | C17H13ClN2O3S2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | methyl 4-(2-chlorophenyl)-2-[(4-methyl-1,3-thiazole-5-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2Cl)csc1NC(=O)c1scnc1C |
| InChI | InChI=1S/C17H13ClN2O3S2/c1-9-14(25-8-19-9)15(21)20-16-13(17(22)23-2)11(7-24-16)10-5-3-4-6-12(10)18/h3-8H,1-2H3,(H,20,21) |
| InChIKey | SICFSYZUPCHKRM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|