C16H16N2O4S — CID 7167092
methyl N-[2-(3-phenylpropanoylamino)thiophene-3-carbonyl]carbamate (PubChem CID 7167092) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is methyl N-[2-(3-phenylpropanoylamino)thiophene-3-carbonyl]carbamate.
| Compound Name | methyl N-[2-(3-phenylpropanoylamino)thiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 7167092 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | methyl N-[2-(3-phenylpropanoylamino)thiophene-3-carbonyl]carbamate |
| SMILES | COC(=O)NC(=O)c1ccsc1NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C16H16N2O4S/c1-22-16(21)18-14(20)12-9-10-23-15(12)17-13(19)8-7-11-5-3-2-4-6-11/h2-6,9-10H,7-8H2,1H3,(H,17,19)(H,18,20,21) |
| InChIKey | GTYYSAMWXWYXBO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |