C15H14FNO3S2 — CID 7546520
methyl 2-[3-(4-fluorophenyl)sulfanylpropanoylamino]thiophene-3-carboxylate (PubChem CID 7546520) has the molecular formula C15H14FNO3S2 and a molecular weight of 339.41 g/mol. Its IUPAC name is methyl 2-[3-(4-fluorophenyl)sulfanylpropanoylamino]thiophene-3-carboxylate.
| Compound Name | methyl 2-[3-(4-fluorophenyl)sulfanylpropanoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 7546520 |
| Molecular Formula | C15H14FNO3S2 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | methyl 2-[3-(4-fluorophenyl)sulfanylpropanoylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1ccsc1NC(=O)CCSc1ccc(F)cc1 |
| InChI | InChI=1S/C15H14FNO3S2/c1-20-15(19)12-6-8-22-14(12)17-13(18)7-9-21-11-4-2-10(16)3-5-11/h2-6,8H,7,9H2,1H3,(H,17,18) |
| InChIKey | ZZBINFGQDBDPIM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |