C14H12FNO5S2 — CID 7544880
methyl 2-[[2-(4-fluorophenyl)sulfonylacetyl]amino]thiophene-3-carboxylate (PubChem CID 7544880) has the molecular formula C14H12FNO5S2 and a molecular weight of 357.38 g/mol. Its IUPAC name is methyl 2-[[2-(4-fluorophenyl)sulfonylacetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(4-fluorophenyl)sulfonylacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 7544880 |
| Molecular Formula | C14H12FNO5S2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | methyl 2-[[2-(4-fluorophenyl)sulfonylacetyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1ccsc1NC(=O)CS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H12FNO5S2/c1-21-14(18)11-6-7-22-13(11)16-12(17)8-23(19,20)10-4-2-9(15)3-5-10/h2-7H,8H2,1H3,(H,16,17) |
| InChIKey | YHTQZOJLSLDDFD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |