C16H17NO5S2 — CID 41145970
methyl 2-[[2-(4-ethylsulfonylphenyl)acetyl]amino]thiophene-3-carboxylate (PubChem CID 41145970) has the molecular formula C16H17NO5S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is methyl 2-[[2-(4-ethylsulfonylphenyl)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(4-ethylsulfonylphenyl)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 41145970 |
| Molecular Formula | C16H17NO5S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | methyl 2-[[2-(4-ethylsulfonylphenyl)acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2sccc2C(=O)OC)cc1 |
| InChI | InChI=1S/C16H17NO5S2/c1-3-24(20,21)12-6-4-11(5-7-12)10-14(18)17-15-13(8-9-23-15)16(19)22-2/h4-9H,3,10H2,1-2H3,(H,17,18) |
| InChIKey | HAVKKEREZNFLHW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |