C17H19NO6S2 — CID 41273904
methyl 2-[4-(4-methoxyphenyl)sulfonylbutanoylamino]thiophene-3-carboxylate (PubChem CID 41273904) has the molecular formula C17H19NO6S2 and a molecular weight of 397.47 g/mol. Its IUPAC name is methyl 2-[4-(4-methoxyphenyl)sulfonylbutanoylamino]thiophene-3-carboxylate.
| Compound Name | methyl 2-[4-(4-methoxyphenyl)sulfonylbutanoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 41273904 |
| Molecular Formula | C17H19NO6S2 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | methyl 2-[4-(4-methoxyphenyl)sulfonylbutanoylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1ccsc1NC(=O)CCCS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H19NO6S2/c1-23-12-5-7-13(8-6-12)26(21,22)11-3-4-15(19)18-16-14(9-10-25-16)17(20)24-2/h5-10H,3-4,11H2,1-2H3,(H,18,19) |
| InChIKey | GOEFXQFCHLCFIO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |