C17H14Cl4F2N2O — CID 21176451
1,3-bis[2,2-dichloro-1-(4-fluorophenyl)ethyl]urea (PubChem CID 21176451) has the molecular formula C17H14Cl4F2N2O and a molecular weight of 442.12 g/mol. Its IUPAC name is 1,3-bis[2,2-dichloro-1-(4-fluorophenyl)ethyl]urea.
| Compound Name | 1,3-bis[2,2-dichloro-1-(4-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 21176451 |
| Molecular Formula | C17H14Cl4F2N2O |
| Molecular Weight | 442.12 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | 1,3-bis[2,2-dichloro-1-(4-fluorophenyl)ethyl]urea |
| SMILES | O=C(NC(c1ccc(F)cc1)C(Cl)Cl)NC(c1ccc(F)cc1)C(Cl)Cl |
| InChI | InChI=1S/C17H14Cl4F2N2O/c18-15(19)13(9-1-5-11(22)6-2-9)24-17(26)25-14(16(20)21)10-3-7-12(23)8-4-10/h1-8,13-16H,(H2,24,25,26) |
| InChIKey | WJYWJAVXJPPYNC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.12 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|