C9H13NO3S — CID 171873595
4-(1,2-dihydroxy-4-sulfanylbutyl)-1H-pyrrole-2-carbaldehyde (PubChem CID 171873595) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is 4-(1,2-dihydroxy-4-sulfanylbutyl)-1H-pyrrole-2-carbaldehyde.
| Compound Name | 4-(1,2-dihydroxy-4-sulfanylbutyl)-1H-pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 171873595 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 4-(1,2-dihydroxy-4-sulfanylbutyl)-1H-pyrrole-2-carbaldehyde |
| SMILES | O=Cc1cc(C(O)C(O)CCS)c[nH]1 |
| InChI | InChI=1S/C9H13NO3S/c11-5-7-3-6(4-10-7)9(13)8(12)1-2-14/h3-5,8-10,12-14H,1-2H2 |
| InChIKey | PHGSJTHNUFWUNQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|