C7H5Cl3N2O3 — CID 91303570
2,2,2-trichloro-1-[4-(nitromethyl)-1H-pyrrol-2-yl]ethanone (PubChem CID 91303570) has the molecular formula C7H5Cl3N2O3 and a molecular weight of 271.49 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[4-(nitromethyl)-1H-pyrrol-2-yl]ethanone.
| Compound Name | 2,2,2-trichloro-1-[4-(nitromethyl)-1H-pyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 91303570 |
| Molecular Formula | C7H5Cl3N2O3 |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 269.94 |
| IUPAC Name | 2,2,2-trichloro-1-[4-(nitromethyl)-1H-pyrrol-2-yl]ethanone |
| SMILES | O=C(c1cc(C[N+](=O)[O-])c[nH]1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H5Cl3N2O3/c8-7(9,10)6(13)5-1-4(2-11-5)3-12(14)15/h1-2,11H,3H2 |
| InChIKey | YJBLBBKOGUKLCI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|