C11H11Cl3N2O2 — CID 169466120
N-[3-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]prop-2-enyl]acetamide (PubChem CID 169466120) has the molecular formula C11H11Cl3N2O2 and a molecular weight of 309.58 g/mol. Its IUPAC name is N-[3-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]prop-2-enyl]acetamide.
| Compound Name | N-[3-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 169466120 |
| Molecular Formula | C11H11Cl3N2O2 |
| Molecular Weight | 309.58 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | N-[3-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC=Cc1c[nH]c(C(=O)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C11H11Cl3N2O2/c1-7(17)15-4-2-3-8-5-9(16-6-8)10(18)11(12,13)14/h2-3,5-6,16H,4H2,1H3,(H,15,17) |
| InChIKey | OMLSQNGRWORQTC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|