C10H14N4O — CID 169465232
N-[3-[2-(methylamino)pyrimidin-5-yl]prop-2-enyl]acetamide (PubChem CID 169465232) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is N-[3-[2-(methylamino)pyrimidin-5-yl]prop-2-enyl]acetamide.
| Compound Name | N-[3-[2-(methylamino)pyrimidin-5-yl]prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 169465232 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | N-[3-[2-(methylamino)pyrimidin-5-yl]prop-2-enyl]acetamide |
| SMILES | CNc1ncc(C=CCNC(C)=O)cn1 |
| InChI | InChI=1S/C10H14N4O/c1-8(15)12-5-3-4-9-6-13-10(11-2)14-7-9/h3-4,6-7H,5H2,1-2H3,(H,12,15)(H,11,13,14) |
| InChIKey | UZWNTBOZXXKOCI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |