C10H12N2O2 — CID 169464931
N-[3-(5-hydroxy-2-pyridinyl)prop-2-enyl]acetamide (PubChem CID 169464931) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is N-[3-(5-hydroxy-2-pyridinyl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(5-hydroxy-2-pyridinyl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 169464931 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | N-[3-(5-hydroxy-2-pyridinyl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC=Cc1ccc(O)cn1 |
| InChI | InChI=1S/C10H12N2O2/c1-8(13)11-6-2-3-9-4-5-10(14)7-12-9/h2-5,7,14H,6H2,1H3,(H,11,13) |
| InChIKey | UBVNQTMTIUNMFB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |