C11H12ClNO2 — CID 169465018
N-[3-(2-chloro-4-hydroxyphenyl)prop-2-enyl]acetamide (PubChem CID 169465018) has the molecular formula C11H12ClNO2 and a molecular weight of 225.68 g/mol. Its IUPAC name is N-[3-(2-chloro-4-hydroxyphenyl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(2-chloro-4-hydroxyphenyl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 169465018 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | N-[3-(2-chloro-4-hydroxyphenyl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC=Cc1ccc(O)cc1Cl |
| InChI | InChI=1S/C11H12ClNO2/c1-8(14)13-6-2-3-9-4-5-10(15)7-11(9)12/h2-5,7,15H,6H2,1H3,(H,13,14) |
| InChIKey | HXQCKRGOHXIXOW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |