C11H12Cl2N2O — CID 169465500
N-[3-(4-amino-2,5-dichlorophenyl)prop-2-enyl]acetamide (PubChem CID 169465500) has the molecular formula C11H12Cl2N2O and a molecular weight of 259.14 g/mol. Its IUPAC name is N-[3-(4-amino-2,5-dichlorophenyl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(4-amino-2,5-dichlorophenyl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 169465500 |
| Molecular Formula | C11H12Cl2N2O |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | N-[3-(4-amino-2,5-dichlorophenyl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC=Cc1cc(Cl)c(N)cc1Cl |
| InChI | InChI=1S/C11H12Cl2N2O/c1-7(16)15-4-2-3-8-5-10(13)11(14)6-9(8)12/h2-3,5-6H,4,14H2,1H3,(H,15,16) |
| InChIKey | MSBBFHDNMFVRMK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|