C11H13NO4 — CID 169466663
N-[3-(2,4,6-trihydroxyphenyl)prop-2-enyl]acetamide (PubChem CID 169466663) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is N-[3-(2,4,6-trihydroxyphenyl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(2,4,6-trihydroxyphenyl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 169466663 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | N-[3-(2,4,6-trihydroxyphenyl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC=Cc1c(O)cc(O)cc1O |
| InChI | InChI=1S/C11H13NO4/c1-7(13)12-4-2-3-9-10(15)5-8(14)6-11(9)16/h2-3,5-6,14-16H,4H2,1H3,(H,12,13) |
| InChIKey | HVESQQIEGNALTA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |