C11H8F5NO — CID 169465940
N-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enyl]acetamide (PubChem CID 169465940) has the molecular formula C11H8F5NO and a molecular weight of 265.18 g/mol. Its IUPAC name is N-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 169465940 |
| Molecular Formula | C11H8F5NO |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | N-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC=Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H8F5NO/c1-5(18)17-4-2-3-6-7(12)9(14)11(16)10(15)8(6)13/h2-3H,4H2,1H3,(H,17,18) |
| InChIKey | UZIFLLZBQFTWEM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|