C6H2Cl4N2O3 — CID 99986405
2,2,2-trichloro-1-(4-chloro-5-nitro-1H-pyrrol-2-yl)ethanone (PubChem CID 99986405) has the molecular formula C6H2Cl4N2O3 and a molecular weight of 291.91 g/mol. Its IUPAC name is 2,2,2-trichloro-1-(4-chloro-5-nitro-1H-pyrrol-2-yl)ethanone.
| Compound Name | 2,2,2-trichloro-1-(4-chloro-5-nitro-1H-pyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 99986405 |
| Molecular Formula | C6H2Cl4N2O3 |
| Molecular Weight | 291.91 g/mol |
| Exact Mass | 289.88 |
| IUPAC Name | 2,2,2-trichloro-1-(4-chloro-5-nitro-1H-pyrrol-2-yl)ethanone |
| SMILES | O=C(c1cc(Cl)c([N+](=O)[O-])[nH]1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H2Cl4N2O3/c7-2-1-3(4(13)6(8,9)10)11-5(2)12(14)15/h1,11H |
| InChIKey | PAWYNDCSAZJVNZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.91 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|