About 2-chloro-5-nitrobenzoyl isothiocyanate
2-chloro-5-nitrobenzoyl isothiocyanate (PubChem CID 15740293) has the molecular formula C8H3ClN2O3S
and a molecular weight of 242.64 g/mol. Its IUPAC name is 2-chloro-5-nitrobenzoyl isothiocyanate.
Molecular Properties
| Compound Name | 2-chloro-5-nitrobenzoyl isothiocyanate |
| PubChem CID | 15740293 |
| Molecular Formula | C8H3ClN2O3S |
| Molecular Weight | 242.64 g/mol |
| Exact Mass | 241.96 |
| IUPAC Name | 2-chloro-5-nitrobenzoyl isothiocyanate |
| SMILES | O=C(N=C=S)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C8H3ClN2O3S/c9-7-2-1-5(11(13)14)3-6(7)8(12)10-4-15/h1-3H |
| InChIKey | UFKBKTJOHGVXLM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.64 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-nitrobenzoyl isothiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-nitrobenzoyl isothiocyanate?
The IUPAC name of 2-chloro-5-nitrobenzoyl isothiocyanate (CID 15740293) is 2-chloro-5-nitrobenzoyl isothiocyanate.
What is the SMILES notation for 2-chloro-5-nitrobenzoyl isothiocyanate?
The canonical SMILES for 2-chloro-5-nitrobenzoyl isothiocyanate is O=C(N=C=S)c1cc([N+](=O)[O-])ccc1Cl.
What is the InChIKey of 2-chloro-5-nitrobenzoyl isothiocyanate?
The InChIKey is UFKBKTJOHGVXLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3ClN2O3S/c9-7-2-1-5(11(13)14)3-6(7)8(12)10-4-15/h1-3H.
What are the key properties of 2-chloro-5-nitrobenzoyl isothiocyanate?
2-chloro-5-nitrobenzoyl isothiocyanate has a molecular weight of 242.64 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-nitrobenzoyl isothiocyanate is sourced from PubChem (CID 15740293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).