C9H9N3O4 — CID 171868161
3-(5-cyano-6-oxo-1H-pyridin-3-yl)-2,3-dihydroxypropanamide (PubChem CID 171868161) has the molecular formula C9H9N3O4 and a molecular weight of 223.19 g/mol. Its IUPAC name is 3-(5-cyano-6-oxo-1H-pyridin-3-yl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(5-cyano-6-oxo-1H-pyridin-3-yl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171868161 |
| Molecular Formula | C9H9N3O4 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 3-(5-cyano-6-oxo-1H-pyridin-3-yl)-2,3-dihydroxypropanamide |
| SMILES | N#Cc1cc(C(O)C(O)C(N)=O)c[nH]c1=O |
| InChI | InChI=1S/C9H9N3O4/c10-2-4-1-5(3-12-9(4)16)6(13)7(14)8(11)15/h1,3,6-7,13-14H,(H2,11,15)(H,12,16) |
| InChIKey | UOSDNQGYJVSOBS-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 140.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |