C11H13ClO5 — CID 171877550
4-(2-chloro-5-methoxyphenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171877550) has the molecular formula C11H13ClO5 and a molecular weight of 260.67 g/mol. Its IUPAC name is 4-(2-chloro-5-methoxyphenyl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(2-chloro-5-methoxyphenyl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171877550 |
| Molecular Formula | C11H13ClO5 |
| Molecular Weight | 260.67 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 4-(2-chloro-5-methoxyphenyl)-3,4-dihydroxybutanoic acid |
| SMILES | COc1ccc(Cl)c(C(O)C(O)CC(=O)O)c1 |
| InChI | InChI=1S/C11H13ClO5/c1-17-6-2-3-8(12)7(4-6)11(16)9(13)5-10(14)15/h2-4,9,11,13,16H,5H2,1H3,(H,14,15) |
| InChIKey | GZSSBNMFCGCCHO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.67 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |