C8H6F3N3O — CID 169485542
3-[2-amino-4-(trifluoromethyl)pyrimidin-5-yl]prop-2-yn-1-ol (PubChem CID 169485542) has the molecular formula C8H6F3N3O and a molecular weight of 217.15 g/mol. Its IUPAC name is 3-[2-amino-4-(trifluoromethyl)pyrimidin-5-yl]prop-2-yn-1-ol.
| Compound Name | 3-[2-amino-4-(trifluoromethyl)pyrimidin-5-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 169485542 |
| Molecular Formula | C8H6F3N3O |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 3-[2-amino-4-(trifluoromethyl)pyrimidin-5-yl]prop-2-yn-1-ol |
| SMILES | Nc1ncc(C#CCO)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H6F3N3O/c9-8(10,11)6-5(2-1-3-15)4-13-7(12)14-6/h4,15H,3H2,(H2,12,13,14) |
| InChIKey | XWARRETVPAZOJT-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|