C7H8N4O — CID 169484738
3-(5,6-diaminopyrazin-2-yl)prop-2-yn-1-ol (PubChem CID 169484738) has the molecular formula C7H8N4O and a molecular weight of 164.17 g/mol. Its IUPAC name is 3-(5,6-diaminopyrazin-2-yl)prop-2-yn-1-ol.
| Compound Name | 3-(5,6-diaminopyrazin-2-yl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 169484738 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 3-(5,6-diaminopyrazin-2-yl)prop-2-yn-1-ol |
| SMILES | Nc1ncc(C#CCO)nc1N |
| InChI | InChI=1S/C7H8N4O/c8-6-7(9)11-5(4-10-6)2-1-3-12/h4,12H,3H2,(H2,8,10)(H2,9,11) |
| InChIKey | CMXPCCWOURNEAV-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|