C10H12F3NO3 — CID 170818491
1-[2-amino-4-(trifluoromethyl)phenyl]propane-1,2,3-triol (PubChem CID 170818491) has the molecular formula C10H12F3NO3 and a molecular weight of 251.20 g/mol. Its IUPAC name is 1-[2-amino-4-(trifluoromethyl)phenyl]propane-1,2,3-triol.
| Compound Name | 1-[2-amino-4-(trifluoromethyl)phenyl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 170818491 |
| Molecular Formula | C10H12F3NO3 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 1-[2-amino-4-(trifluoromethyl)phenyl]propane-1,2,3-triol |
| SMILES | Nc1cc(C(F)(F)F)ccc1C(O)C(O)CO |
| InChI | InChI=1S/C10H12F3NO3/c11-10(12,13)5-1-2-6(7(14)3-5)9(17)8(16)4-15/h1-3,8-9,15-17H,4,14H2 |
| InChIKey | LURONOOHDPYGHV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|