C12H17F3N2O2 — CID 171890868
1-[2-amino-5-(trifluoromethyl)phenyl]-4-(methylamino)butane-1,2-diol (PubChem CID 171890868) has the molecular formula C12H17F3N2O2 and a molecular weight of 278.27 g/mol. Its IUPAC name is 1-[2-amino-5-(trifluoromethyl)phenyl]-4-(methylamino)butane-1,2-diol.
| Compound Name | 1-[2-amino-5-(trifluoromethyl)phenyl]-4-(methylamino)butane-1,2-diol |
|---|---|
| PubChem CID | 171890868 |
| Molecular Formula | C12H17F3N2O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 1-[2-amino-5-(trifluoromethyl)phenyl]-4-(methylamino)butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1cc(C(F)(F)F)ccc1N |
| InChI | InChI=1S/C12H17F3N2O2/c1-17-5-4-10(18)11(19)8-6-7(12(13,14)15)2-3-9(8)16/h2-3,6,10-11,17-19H,4-5,16H2,1H3 |
| InChIKey | RJXHAXOSEWDBDD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|