C8H7ClFNO4 — CID 170825058
3-(5-chloro-2-fluoro-4-pyridinyl)-2,3-dihydroxypropanoic acid (PubChem CID 170825058) has the molecular formula C8H7ClFNO4 and a molecular weight of 235.60 g/mol. Its IUPAC name is 3-(5-chloro-2-fluoro-4-pyridinyl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(5-chloro-2-fluoro-4-pyridinyl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170825058 |
| Molecular Formula | C8H7ClFNO4 |
| Molecular Weight | 235.60 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 3-(5-chloro-2-fluoro-4-pyridinyl)-2,3-dihydroxypropanoic acid |
| SMILES | O=C(O)C(O)C(O)c1cc(F)ncc1Cl |
| InChI | InChI=1S/C8H7ClFNO4/c9-4-2-11-5(10)1-3(4)6(12)7(13)8(14)15/h1-2,6-7,12-13H,(H,14,15) |
| InChIKey | FJMBHTXJQNVQJN-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.60 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|