C7H7ClN2O4 — CID 76696734
3-(6-chloropyrazin-2-yl)-2,3-dihydroxypropanoic acid (PubChem CID 76696734) has the molecular formula C7H7ClN2O4 and a molecular weight of 218.60 g/mol. Its IUPAC name is 3-(6-chloropyrazin-2-yl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(6-chloropyrazin-2-yl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 76696734 |
| Molecular Formula | C7H7ClN2O4 |
| Molecular Weight | 218.60 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | 3-(6-chloropyrazin-2-yl)-2,3-dihydroxypropanoic acid |
| SMILES | O=C(O)C(O)C(O)c1cncc(Cl)n1 |
| InChI | InChI=1S/C7H7ClN2O4/c8-4-2-9-1-3(10-4)5(11)6(12)7(13)14/h1-2,5-6,11-12H,(H,13,14) |
| InChIKey | BZKYCHDMOLQVAV-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.60 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |