About 5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde
5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde (PubChem CID 170817631) has the molecular formula C9H11NO4
and a molecular weight of 197.19 g/mol. Its IUPAC name is 5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde |
| PubChem CID | 170817631 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde |
| SMILES | O=Cc1cncc(C(O)C(O)CO)c1 |
| InChI | InChI=1S/C9H11NO4/c11-4-6-1-7(3-10-2-6)9(14)8(13)5-12/h1-4,8-9,12-14H,5H2 |
| InChIKey | VYVQIXNJVQKPJW-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde?
The IUPAC name of 5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde (CID 170817631) is 5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde.
What is the SMILES notation for 5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde?
The canonical SMILES for 5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde is O=Cc1cncc(C(O)C(O)CO)c1.
What is the InChIKey of 5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde?
The InChIKey is VYVQIXNJVQKPJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4/c11-4-6-1-7(3-10-2-6)9(14)8(13)5-12/h1-4,8-9,12-14H,5H2.
What are the key properties of 5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde?
5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde has a molecular weight of 197.19 g/mol, XLogP of -0.72, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde is sourced from PubChem (CID 170817631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).