C9H11NO4 — CID 170817631
5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde (PubChem CID 170817631) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde.
| Compound Name | 5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 170817631 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 5-(1,2,3-trihydroxypropyl)pyridine-3-carbaldehyde |
| SMILES | O=Cc1cncc(C(O)C(O)CO)c1 |
| InChI | InChI=1S/C9H11NO4/c11-4-6-1-7(3-10-2-6)9(14)8(13)5-12/h1-4,8-9,12-14H,5H2 |
| InChIKey | VYVQIXNJVQKPJW-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|