C8H8N4O4 — CID 171870734
3-(4-amino-5-nitro-3-pyridinyl)-2,3-dihydroxypropanenitrile (PubChem CID 171870734) has the molecular formula C8H8N4O4 and a molecular weight of 224.18 g/mol. Its IUPAC name is 3-(4-amino-5-nitro-3-pyridinyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(4-amino-5-nitro-3-pyridinyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171870734 |
| Molecular Formula | C8H8N4O4 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 3-(4-amino-5-nitro-3-pyridinyl)-2,3-dihydroxypropanenitrile |
| SMILES | N#CC(O)C(O)c1cncc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C8H8N4O4/c9-1-6(13)8(14)4-2-11-3-5(7(4)10)12(15)16/h2-3,6,8,13-14H,(H2,10,11) |
| InChIKey | TZBCLMBXTDJSNK-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|