C9H7ClN2O4 — CID 171870679
3-(2-chloro-6-nitrophenyl)-2,3-dihydroxypropanenitrile (PubChem CID 171870679) has the molecular formula C9H7ClN2O4 and a molecular weight of 242.62 g/mol. Its IUPAC name is 3-(2-chloro-6-nitrophenyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(2-chloro-6-nitrophenyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171870679 |
| Molecular Formula | C9H7ClN2O4 |
| Molecular Weight | 242.62 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 3-(2-chloro-6-nitrophenyl)-2,3-dihydroxypropanenitrile |
| SMILES | N#CC(O)C(O)c1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7ClN2O4/c10-5-2-1-3-6(12(15)16)8(5)9(14)7(13)4-11/h1-3,7,9,13-14H |
| InChIKey | ZMPJBOZCDRVXRD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 107.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.62 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|