C9H10ClNO5S2 — CID 134882681
1-chloro-3-nitro-2-(1-sulfosulfanylpropan-2-yl)benzene (PubChem CID 134882681) has the molecular formula C9H10ClNO5S2 and a molecular weight of 311.77 g/mol. Its IUPAC name is 1-chloro-3-nitro-2-(1-sulfosulfanylpropan-2-yl)benzene.
| Compound Name | 1-chloro-3-nitro-2-(1-sulfosulfanylpropan-2-yl)benzene |
|---|---|
| PubChem CID | 134882681 |
| Molecular Formula | C9H10ClNO5S2 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | 1-chloro-3-nitro-2-(1-sulfosulfanylpropan-2-yl)benzene |
| SMILES | CC(CSS(=O)(=O)O)c1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10ClNO5S2/c1-6(5-17-18(14,15)16)9-7(10)3-2-4-8(9)11(12)13/h2-4,6H,5H2,1H3,(H,14,15,16) |
| InChIKey | MAYHXIWWZSNSOG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|