About methyl 2,3-dihydroxy-3-(1-oxo-2,3-dihydroinden-4-yl)propanoate
methyl 2,3-dihydroxy-3-(1-oxo-2,3-dihydroinden-4-yl)propanoate (PubChem CID 171864253) has the molecular formula C13H14O5
and a molecular weight of 250.25 g/mol. Its IUPAC name is methyl 2,3-dihydroxy-3-(1-oxo-2,3-dihydroinden-4-yl)propanoate.
Analyze methyl 2,3-dihydroxy-3-(1-oxo-2,3-dihydroinden-4-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,3-dihydroxy-3-(1-oxo-2,3-dihydroinden-4-yl)propanoate?
The IUPAC name of methyl 2,3-dihydroxy-3-(1-oxo-2,3-dihydroinden-4-yl)propanoate (CID 171864253) is methyl 2,3-dihydroxy-3-(1-oxo-2,3-dihydroinden-4-yl)propanoate.
What is the SMILES notation for methyl 2,3-dihydroxy-3-(1-oxo-2,3-dihydroinden-4-yl)propanoate?
The canonical SMILES for methyl 2,3-dihydroxy-3-(1-oxo-2,3-dihydroinden-4-yl)propanoate is COC(=O)C(O)C(O)c1cccc2c1CCC2=O.
What is the InChIKey of methyl 2,3-dihydroxy-3-(1-oxo-2,3-dihydroinden-4-yl)propanoate?
The InChIKey is JCXQNARPDLNYKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O5/c1-18-13(17)12(16)11(15)9-4-2-3-8-7(9)5-6-10(8)14/h2-4,11-12,15-16H,5-6H2,1H3.
What are the key properties of methyl 2,3-dihydroxy-3-(1-oxo-2,3-dihydroinden-4-yl)propanoate?
methyl 2,3-dihydroxy-3-(1-oxo-2,3-dihydroinden-4-yl)propanoate has a molecular weight of 250.25 g/mol, XLogP of 0.38, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,3-dihydroxy-3-(1-oxo-2,3-dihydroinden-4-yl)propanoate is sourced from PubChem (CID 171864253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).