C11H8F2N2OS — CID 108889251
1-(2,5-difluorophenyl)-3-thiophen-2-ylurea (PubChem CID 108889251) has the molecular formula C11H8F2N2OS and a molecular weight of 254.26 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-thiophen-2-ylurea.
| Compound Name | 1-(2,5-difluorophenyl)-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 108889251 |
| Molecular Formula | C11H8F2N2OS |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-thiophen-2-ylurea |
| SMILES | O=C(Nc1cccs1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C11H8F2N2OS/c12-7-3-4-8(13)9(6-7)14-11(16)15-10-2-1-5-17-10/h1-6H,(H2,14,15,16) |
| InChIKey | CGZUTFCGZOEOMZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |